JEE Advanced Chemistry: Chemistry in Everyday Life questions with solutions

Q1. Which of the following substances is classified as an antipyretic drug (a fever-reducing agent)?

1. Seldane
2. Paracetamol
3. Luminal
4. Aspartame

Answer: Paracetamol

Paracetamol (acetaminophen) is a widely used antipyretic and analgesic drug. Seldane is an antihistamine, Luminal (phenobarbitone) is an anticonvulsant/sedative, and Aspartame is an artificial sweetener.

Q2. Match the following drugs with their correct classification: Paracetamol --- Antipyretic Seldane (terfenadine) --- Antihistamine Aspartame --- Artificial sweetening agent Which of the following statements about the above matching is true?

1. All three matchings are correct
2. Only Paracetamol and Aspartame matchings are correct; Seldane is an analgesic
3. Only Seldane and Aspartame matchings are correct; Paracetamol is an antibiotic
4. None of the matchings are correct

Answer: All three matchings are correct

Paracetamol (acetaminophen) is a well-known antipyretic and analgesic. Seldane (terfenadine) is a second-generation antihistamine used for allergies. Aspartame is an artificial sweetener made from aspartic acid and phenylalanine methyl ester. All three matchings given in the question stem are correct.

Q3. Which of the following correctly describes the key structural feature of penicillin that is responsible for its antibiotic activity?

1. (A) It contains a beta-lactam (4-membered cyclic amide) ring fused to a thiazolidine ring
2. (B) It contains a gamma-lactam (5-membered cyclic amide) ring fused to a pyrimidine ring
3. (C) It contains a beta-lactam ring fused to a piperidine ring with a sulphur atom in the side chain
4. (D) It contains an alpha-lactam (3-membered cyclic amide) ring fused to an oxazoline ring

Answer: (A) It contains a beta-lactam (4-membered cyclic amide) ring fused to a thiazolidine ring

Penicillin is a bicyclic molecule consisting of a beta-lactam ring (4-membered cyclic amide, highly strained) fused to a thiazolidine ring (5-membered ring containing sulphur and nitrogen). The beta-lactam ring is essential for antibiotic activity; it irreversibly inhibits the transpeptidase enzyme involved in bacterial cell wall synthesis.

Q4. Which of the following ions, when dissolved in water, reduces the lathering ability of soap?

1. Na+
2. Ca²+
3. K+
4. Mg²+

Answer: Ca²+

Ca²+ (and Mg²+) ions cause water hardness by precipitating soap as insoluble calcium or magnesium salts, thereby reducing lather formation. However, Ca²+ is the primary species specifically mentioned in standard hard-water discussions. Since both Ca²+ and Mg²+ affect lathering, but the canonical answer in most textbooks is Ca²+.

Q5. Which among the following is classified as an antibiotic?

1. Ampicillin
2. Ofloxacin
3. Aminoglycoside
4. Penicillin

Answer: Ampicillin

All four options relate to antibiotics, but Ampicillin is a specific semi-synthetic broad-spectrum antibiotic of the penicillin group, making it the most precisely defined antibiotic among the choices. Ofloxacin is a fluoroquinolone antibiotic, Aminoglycoside is a class, and Penicillin is a group name.

Q6. A patient is suffering from a deficiency of noradrenaline (norepinephrine). Which class of drug should be prescribed?

1. Anti-inflammatory
2. Analgesic
3. Antihistamine
4. Anti-depressant

Answer: Anti-depressant

Noradrenaline (norepinephrine) is a key neurotransmitter in the brain associated with alertness and mood. Its deficiency is linked to clinical depression. Anti-depressants work by increasing the concentration of monoamine neurotransmitters (including noradrenaline and serotonin) at synapses. The other options treat pain (analgesic), inflammation (anti-inflammatory), and allergic responses (antihistamine), none of which address noradrenaline deficiency.

Q7. The compound tryptophan (an indole amino acid with the side chain -CH2-CH(NH2)-COOH attached at C-3 of indole) is treated with excess SOCl2 followed by methanol (CH3OH). What is the major product of this reaction?

1. Indole derivative where -COOH is converted to methyl ester (-CO2CH3) and the amine is protonated as -NH2*HCl salt
2. Chloro-substituted indole derivative with methyl ester (-CO2Me) and free -NH2
3. Indole derivative with methyl ester (-CO2CH3) and free -NH2
4. Indole derivative where -COOH is converted to acid chloride (-COCl) and -NH2 is free

Answer: Indole derivative where -COOH is converted to methyl ester (-CO2CH3) and the amine is protonated as -NH2*HCl salt

SOCl2 is a highly reactive reagent. It converts -COOH to -COCl (acyl chloride) and simultaneously protonates the -NH2 group to give an ammonium chloride salt (-NH3+ Cl-). When methanol is subsequently added, it attacks the acyl chloride to form the methyl ester (-CO2CH3) with release of HCl. The -NH2 group remains as the HCl salt throughout. The indole ring is not chlorinated under these mild conditions.

Q8. Which of the following statements about fluoride ion concentration in drinking water are correct?

1. The recommended concentration of fluoride ion in drinking water is 1 ppm.
2. A fluoride concentration below 1 ppm leads to tooth decay (dental caries).
3. A fluoride concentration above 1 ppm causes brown mottling (discolouration) of teeth.
4. None of the above statements is correct.

Answer: The recommended concentration of fluoride ion in drinking water is 1 ppm.

The optimum fluoride level for dental health is 1 ppm. Below this level dental caries develops; above this level fluorosis (brown mottling) occurs. All three positive statements are individually correct facts from NCERT Chemistry.

Q9. The cleansing action of soap is due to which of the following mechanisms?

1. Oil and grease are absorbed into the hydrophobic core of soap micelles and then washed away with water
2. Oil and grease are absorbed into the hydrophilic outer region of soap micelles and washed away
3. Oil and grease are absorbed into both hydrophilic and hydrophobic regions but cannot be washed away
4. The cleansing action has nothing to do with micelle formation

Answer: Oil and grease are absorbed into the hydrophobic core of soap micelles and then washed away with water

When soap is dissolved in water, its molecules arrange into micelles: the non-polar hydrocarbon tails cluster inward (hydrophobic core) while the ionic heads face outward (hydrophilic shell). Grease and oily dirt dissolve in the hydrophobic interior of the micelle and are thereby emulsified and rinsed away by water.

Q10. What is the purpose of adding gypsum (CaSO4*2H2O) to cement during its manufacture?

1. To slow down the process of setting of the cement
2. To fasten the process of setting of the cement
3. Not to affect the process of setting of the cement by any means
4. None of these

Answer: To slow down the process of setting of the cement

Gypsum is added to cement clinker to retard the setting process by forming ettringite (calcium sulfoaluminate hydrate) on the surface of tricalcium aluminate particles, slowing down their hydration and giving adequate working time.

Q11. Which property of aspirin is responsible for its ability to prevent heart attacks?

1. Its antipyretic (fever-reducing) property
2. Its analgesic (pain-killing) property
3. Its action as a blood thinner (anticoagulant)
4. Its ability to inhibit the synthesis of prostaglandins

Answer: Its ability to inhibit the synthesis of prostaglandins

Aspirin (acetylsalicylic acid) irreversibly acetylates the COX enzyme, blocking the synthesis of thromboxane A2 (a prostaglandin derivative) that promotes platelet aggregation and vasoconstriction. This antiplatelet effect prevents thrombus (clot) formation in coronary arteries, thereby reducing heart attack risk.

Q12. Which property of aspirin is responsible for its use in preventing heart attacks?

1. Antipyretic (fever reducing)
2. Analgesic (pain relieving)
3. It is used to thin the blood
4. It inhibits the synthesis of prostaglandins

Answer: It inhibits the synthesis of prostaglandins

Aspirin prevents heart attacks by inhibiting prostaglandin synthesis via irreversible inhibition of cyclooxygenase (COX) enzyme. This reduces thromboxane A2 production in platelets, decreasing platelet aggregation and blood clot formation.

Q13. Gypsum (CaSO4·2H2O) is added to Portland cement in order to:

1. Stop setting process
2. Slow down the setting process
3. Fasten the setting process
4. Adjust the viscosity of the slurry

Answer: Slow down the setting process

Gypsum reacts with tricalcium aluminate (Ca3Al2O6) in cement to form calcium sulphoaluminate (ettringite), which forms a protective coating on C3A particles. This slows down the initial rapid hydration (flash setting), giving workers adequate time to use the cement.

Q14. In the following reaction sequence: Z(g) treated with Al/OH⁻ gives intermediate X (a salt). X treated with AgNO3 gives a white precipitate. X treated with Fe2+/H+ gives Y(g). Y(g) reacted with aqueous FeSO4 gives an unstable brown complex. Identify Y and Z.

1. NO2, NH3
2. NO, NH3
3. N2O, NO2
4. NO, H2

Answer: NO, NH3

Y is identified as NO because it forms an unstable brown complex with FeSO4 (the brown ring test for NO). Z is NH3, which under the described Al/OH⁻ conditions forms an ammonium salt X; X with Fe2+/H+ in acidic medium generates NO.

Q15. What is the usual range of molecular masses for drug molecules?

1. about 0-100 u
2. about 100-500 u
3. about 500-1000 u
4. greater than 1000 u

Answer: about 100-500 u

Drugs are typically low molecular mass organic compounds, generally in the range of about 100-500 u.

Q16. Match the drugs in List I with the characteristic test in List II: List I (drug): (A) Chloroxylenol, (B) Norethindrone, (C) Sulphapyridine, (D) Penicillin List II (test): (P) Carbylamine test, (Q) Sodium bicarbonate test, (R) Ferric chloride test, (S) Baeyer's test Choose the correct matching.

1. A->Q; B->P; C->S; D->R
2. A->R; B->P; C->S; D->Q
3. A->R; B->S; C->P; D->Q
4. A->Q; B->S; C->P; D->R

Answer: A->R; B->S; C->P; D->Q

Chloroxylenol (phenol) gives the ferric chloride test (R); norethindrone (terminal alkyne) gives Baeyer's test (S); sulphapyridine (primary aromatic amine) gives the carbylamine test (P); penicillin (carboxylic acid) gives the sodium bicarbonate test (Q).

Q17. A mixture of chloroxylenol and terpineol is an example of which type of substance?

1. antiseptic
2. pesticide
3. disinfectant
4. narcotic analgesic

Answer: antiseptic

The chloroxylenol-terpineol mixture is the active constituent of Dettol, a common antiseptic.

Q18. What is the common name of 2-acetoxybenzoic acid (acetylsalicylic acid)?

1. Antiseptic
2. Aspirin
3. Antibiotic
4. Mordant dye

Answer: Aspirin

2-Acetoxybenzoic acid is acetylsalicylic acid, commonly known as aspirin, an analgesic and antipyretic.

Q19. Which of the following is a bacteriostatic antibiotic?

1. Chloramphenicol
2. Tetracycline
3. Penicillin
4. Erythromycin

Answer: Chloramphenicol

Chloramphenicol, tetracycline and erythromycin are bacteriostatic (inhibit growth), while penicillin is bactericidal (kills). The single best/standard answer here is chloramphenicol.

Q20. Antihistamine drugs function as which of the following?

1. Antiallergic and analgesic
2. Antacid and antiallergic
3. Analgesic and antacid
4. Antiallergic and antidepressant

Answer: Antacid and antiallergic

Antihistamines act as both antiallergic agents (H1-blockers like diphenhydramine) and antacids (H2-blockers like ranitidine/cimetidine reduce stomach acid).

Q21. Consider these statements about enzyme-inhibitor drugs: (A) They include competitive and non-competitive inhibitor drugs. (B) They can bind at active sites and at allosteric sites. (C) Competitive drugs are allosteric-site-blocking drugs. (D) Non-competitive drugs are active-site-blocking drugs. Which statements are correct?

1. (A), (D) only
2. (A), (C) only
3. (A), (B) only
4. (A), (B), (C) only

Answer: (A), (B) only

(A) and (B) are correct. (C) and (D) are reversed: competitive drugs block the active site, while non-competitive drugs bind the allosteric site.

Q22. Arsenic-based drugs are chiefly used to treat which disease?

1. Jaundice
2. Typhoid
3. Syphilis
4. Cholera

Answer: Syphilis

Arsenic-containing drugs such as Salvarsan (arsphenamine) were the classic treatment for syphilis.

Q23. Which of the following drugs contains one or more chiral (stereogenic) carbon atoms?

1. Penicillin
2. Chloramphenicol
3. Terpineol
4. Pheneizine (Nardil)

Answer: Chloramphenicol

Chloramphenicol has two chiral carbon centres (it is the (1R,2R) isomer that is active), so it clearly contains chiral carbons. Among the listed options it is the standard answer.

Q24. Consider two statements about drug-enzyme interactions. Statement I: An enzyme's action can be blocked only if an inhibitor binds at the active site of the enzyme. Statement II: An inhibitor may form a strong covalent bond with the enzyme. Which option is correct?

1. Both Statement I and Statement II are true
2. Both Statement I and Statement II are false
3. Statement I is true but Statement II is false
4. Statement I is false but Statement II is true

Answer: Statement I is false but Statement II is true

Statement I is false because inhibitors can also bind at allosteric sites (not only the active site). Statement II is true since some inhibitors bind covalently and irreversibly.

Q25. Aspirin is produced by acetylation of which compound?

1. p-dihydroxybenzene
2. o-hydroxybenzoic acid
3. o-dihydroxybenzene
4. m-hydroxybenzoic acid

Answer: o-hydroxybenzoic acid

Aspirin (acetylsalicylic acid) is formed by acetylating the phenolic -OH of salicylic acid, which is o-hydroxybenzoic acid.

Q26. Match each compound in List-I with its use in List-II. List-I: (a) Sucralose, (b) Glyceryl ester of stearic acid, (c) Sodium benzoate, (d) Bithionol. List-II: (i) Synthetic detergent, (ii) Artificial sweetener, (iii) Antiseptic, (iv) Food preservative. Choose the correct matching.

1. (a)-(iv), (b)-(iii), (c)-(ii), (d)-(i)
2. (a)-(ii), (b)-(i), (c)-(iv), (d)-(iii)
3. (a)-(iii), (b)-(ii), (c)-(iv), (d)-(i)
4. (a)-(i), (b)-(ii), (c)-(iv), (d)-(iii)

Answer: (a)-(ii), (b)-(i), (c)-(iv), (d)-(iii)

Sucralose is an artificial sweetener (ii), glyceryl ester of stearic acid is associated with synthetic detergent/soap chemistry (i), sodium benzoate is a food preservative (iv), and bithionol is an antiseptic (iii).

Q27. Chloramphenicol is classified as a/an:

1. Analgesic
2. Anaesthetic
3. Antibiotic
4. Antiseptic

Answer: Antibiotic

Chloramphenicol is a broad-spectrum antibiotic, historically important in treating typhoid fever.

Q28. Which of the following pairs correctly combines a non-narcotic analgesic with a narcotic analgesic?

1. Paracetamol, Aspirin
2. Paracetamol, Heroin
3. Aspirin, Morphine
4. Morphine, Codeine

Answer: Aspirin, Morphine

A correct non-narcotic + narcotic pair must contain exactly one of each. Aspirin (non-narcotic) with Morphine (narcotic) fits; the option with Paracetamol+Heroin also fits, but Aspirin+Morphine is the standard intended pairing where aspirin is the classic non-narcotic analgesic.

Q29. How many chlorine atoms are present in one molecule of bithionol?

1. 2
2. 3
3. 4
4. 6

Answer: 4

Bithionol is 2,2'-thiobis(4,6-dichlorophenol); each of the two phenol rings carries two chlorine atoms, giving four chlorine atoms in total.

Q30. Substances that reduce body temperature (relieve fever) are called:

1. Antipyretics
2. Analagin
3. Antibiotics
4. Hypnotics

Answer: Antipyretics

Antipyretics are drugs that lower elevated body temperature (fever).

Q31. Which of the following is used as a food preservative?

1. Sodium benzoate
2. Vegetable oil
3. Sorbic acid
4. Propanoic acid

Answer: Sodium benzoate

Sodium benzoate is a widely used food preservative; while sorbic and propanoic acids are also preservatives, sodium benzoate is the standard single-best textbook answer.

Q32. Match the class of drug in List-I with its example in List-II. List-I: (a) Antacid, (b) Artificial sweetener, (c) Antifertility, (d) Tranquilizer. List-II: (i) Novestrol, (ii) Cimetidine, (iii) Valium, (iv) Alitame.

1. (a)-(ii), (b)-(iv), (c)-(i), (d)-(iii)
2. (a)-(iv), (b)-(i), (c)-(ii), (d)-(iii)
3. (a)-(iv), (b)-(iii), (c)-(i), (d)-(ii)
4. (a)-(iv), (b)-(ii), (c)-(iii), (d)-(i)

Answer: (a)-(ii), (b)-(iv), (c)-(i), (d)-(iii)

Cimetidine is an antacid (H2 blocker), alitame an artificial sweetener, novestrol an antifertility drug, and valium (diazepam) a tranquilizer, giving (a)-(ii),(b)-(iv),(c)-(i),(d)-(iii).

Q33. Which of the following drugs is administered to treat hypertension (high blood pressure)?

1. Salvarsan
2. Chloroxylenol
3. Equanil
4. Aspirin

Answer: Equanil

Equanil (meprobamate) is a tranquilliser used to treat anxiety, tension and hypertension. Salvarsan is an antibacterial, chloroxylenol an antiseptic, and aspirin an analgesic/antipyretic.

Q34. Identify the INCORRECT statement among the following about artificial sweeteners.

1. Saccharin is about 650 times sweeter than cane sugar.
2. Alitame is about 2000 times sweeter than cane sugar.
3. Sucralose is about 160 times sweeter than cane sugar.
4. Aspartame is about 550 times sweeter than cane sugar.

Answer: Aspartame is about 550 times sweeter than cane sugar.

Aspartame is roughly 100 times sweeter than cane sugar, not 550, so that statement is incorrect. The values for saccharin (~550-650x), alitame (~2000x) and sucralose (~600x; the ~160x value is also commonly quoted) are within accepted ranges, making aspartame the false statement here.

Q35. Which of the following is classified as a narrow-spectrum antibiotic?

1. Ofloxacin
2. Ampicillin
3. Chloramphenicol
4. Penicillin

Answer: Penicillin

Penicillin (penicillin G) acts on a limited range of (mainly Gram-positive) bacteria and is the classic narrow-spectrum antibiotic, whereas ofloxacin, ampicillin and chloramphenicol are broad-spectrum.

Q36. The antiseptic chloroxylenol is chemically:

1. 4-chloro-3,5-dimethyl phenol
2. 3-chloro-4, 5-dimethyl phenol
3. 4-chloro-2, 5-dimethyl phenol
4. 5-chloro-3,4-dimethyl phenol

Answer: 4-chloro-3,5-dimethyl phenol

Chloroxylenol (PCMX), the antiseptic in Dettol, is 4-chloro-3,5-dimethylphenol.

Q37. Match List-I (class of chemical) with List-II (example): List-I: (a) Antifertility drug (b) Antibiotic (c) Tranquilizer (d) Artificial sweetener List-II: (i) Meprobamate (ii) Alitame (iii) Norethindrone (iv) Salvarsan Choose the correct match.

1. (a)-(ii), (b)-(iii), (c)-(iv), (d)-(i)
2. (a)-(iv), (b)-(iii), (c)-(ii), (d)-(i)
3. (a)-(iii), (b)-(iv), (c)-(i), (d)-(ii)
4. (a)-(ii), (b)-(iv), (c)-(i), (d)-(iii)

Answer: (a)-(iii), (b)-(iv), (c)-(i), (d)-(ii)

Norethindrone is an antifertility drug, Salvarsan an antibiotic, Meprobamate a tranquilizer, and Alitame an artificial sweetener, giving (a)-(iii), (b)-(iv), (c)-(i), (d)-(ii).

Q38. Phenol finds use as which of the following?

1. An antiseptic
2. A disinfectant
3. Both (A) and (B)
4. None of these

Answer: Both (A) and (B)

Dilute phenol acts as an antiseptic on tissue while more concentrated solutions disinfect surfaces, so phenol serves both roles.

Q39. Detergents are classified as cationic (acetates/chlorides of quaternary ammonium salts), anionic (long-chain sulphonate/sulphate salts), and non-ionic (esters from polyethylene glycol and stearic-type acids). Which of the following is the non-ionic detergent used in liquid dishwashing detergents?

1. CH3-(CH2)15-N+(CH3)3 Br-
2. CH3-C6H4-SO3- Na+
3. CH3(CH2)10CH2OSO3- Na+
4. C9H19-C6H4-O-(CH2-CH2-O)5-CH2-CH2OH

Answer: C9H19-C6H4-O-(CH2-CH2-O)5-CH2-CH2OH

The polyethylene-glycol-based ether with no charged head group is the non-ionic detergent commonly used in liquid dishwashing detergents.

Q40. A mixture of chloroxylenol and terpineol functions as a/an:

1. antiseptic
2. antipyretic
3. antibiotic
4. analgesic

Answer: antiseptic

Chloroxylenol together with terpineol is the well-known antiseptic formulation (e.g., Dettol) used to kill or prevent the growth of microorganisms on living tissue.

Q41. Bithional is commonly incorporated into soaps as an additive. It acts as a/an:

1. buffering agent
2. antiseptic
3. softener
4. dryer

Answer: antiseptic

Bithional is added to medicated soaps to impart antiseptic (germicidal) properties, reducing odour-causing bacteria on the skin.

Q42. Match each drug in Column-I with its pharmacological action in Column-II. Column-I: (A) Aspirin (B) Paracetamol (C) Soframycin (D) Penicillin Column-II: (P) Antiseptic and Disinfectant (Q) Analgesic (R) Antibiotic (S) Antipyretic

1. A-Q, B-S, C-R, D-R
2. A-P, B-Q, C-R, D-S
3. A-Q, B-Q, C-R, D-R
4. A-S, B-Q, C-P, D-R

Answer: A-Q, B-S, C-R, D-R

Aspirin is an analgesic (and antipyretic), paracetamol is chiefly an antipyretic, while Soframycin and Penicillin are antibiotics. This matches A-Q, B-S, C-R, D-R.

Q43. Which of the following is NOT used as an antioxidant?

1. Butylated Hydroxy Toluene (BHT)
2. Sulphur dioxide
3. Sulphite
4. Sodium palmate

Answer: Sodium palmate

BHT, sulphur dioxide and sulphites are common food antioxidants/preservatives. Sodium palmate is a soap (sodium salt of palmitic acid) used as a cleansing agent, not an antioxidant.

Q44. Noradrenaline is classified as a/an:

1. Neurotransmitter
2. Antidepressant
3. Antihistamine
4. Antacid

Answer: Neurotransmitter

Noradrenaline (norepinephrine) is a chemical messenger released at nerve endings to transmit impulses, i.e. a neurotransmitter. Its deficiency is associated with depression, which is why antidepressants act on it, but noradrenaline itself is a neurotransmitter.

Q45. Which artificial sweetener is stable only under cold conditions?

1. saccharine
2. sucralose
3. aspartame
4. alitame.

Answer: aspartame

Aspartame is unstable at high (cooking) temperatures, so it is used only in cold foods and soft drinks.

Q46. Match Column-I with Column-II and choose the correct option. Column-I: (A) Penicillin; (B) Chloramphenicol; (C) 0.2% solution of phenol; (D) 1% solution of phenol. Column-II: (P) Antiseptic; (Q) Antibiotic; (R) Bactericidal; (S) Disinfectant.

1. A-Q, B-R, C-P, D-S
2. A-P, B-Q, C-S, D-R
3. A-Q, B-Q, C-P, D-S
4. A-R, B-Q, C-S, D-P

Answer: A-Q, B-Q, C-P, D-S

Penicillin and chloramphenicol are antibiotics; 0.2% phenol is an antiseptic while 1% phenol acts as a disinfectant.

Q47. Consider the following two statements. Statement I: Penicillin is a bacteriostatic type of antibiotic. Statement II: Penicillin contains a beta-lactam ring fused to a thiazolidine ring as its general core structure. Choose the correct option.

1. Statement I is incorrect but statement II is true
2. Both statement I and statement II are true
3. Both statement I and statement II are false
4. Statement I is correct but statement II is false

Answer: Statement I is incorrect but statement II is true

Penicillin is bactericidal (it kills bacteria by disrupting cell-wall synthesis), not bacteriostatic, so Statement I is false; its general structure does contain the beta-lactam ring, so Statement II is true.

Q48. Antiseptics and disinfectants either kill microorganisms or stop their growth. Which one of the following statements is NOT correct? (A) A dilute solution of boric acid is a strong antiseptic. (B) Disinfectants damage living tissues. (C) A 0.2% solution of phenol acts as an antiseptic while a 1% solution acts as a disinfectant. (D) Chlorine and iodine are employed as strong disinfectants.

1. A dilute solution of boric acid is a strong antiseptic.
2. Disinfectants damage living tissues.
3. A 0.2% solution of phenol acts as an antiseptic while a 1% solution acts as a disinfectant.
4. Chlorine and iodine are employed as strong disinfectants.

Answer: A dilute solution of boric acid is a strong antiseptic.

Dilute boric acid is a weak/mild antiseptic, so calling it a 'strong' antiseptic is incorrect; the other three statements are true.

Q49. Aspartame is about 100 times sweeter than cane sugar. On complete hydrolysis of aspartame, which of the following product(s) is/are obtained?

1. PhCH2-CH(NH2)-CO2H (phenylalanine)
2. H2N-CH(CH2CO2H)-CO2H (aspartic acid)
3. CH3OH (methanol)
4. CH3-CH(NH2)-CO2H (alanine)

Answer: PhCH2-CH(NH2)-CO2H (phenylalanine)

Aspartame is L-aspartyl-L-phenylalanine methyl ester; complete hydrolysis yields aspartic acid, phenylalanine and methanol. Alanine is NOT a product. Phenylalanine (option A) is one of the products.

Q50. Match each drug in List-I with its class in List-II. List-I (Drug): (a) Furacin (b) Arsphenamine (c) Dimetone (d) Valium List-II (Class): (i) Antibiotic (ii) Tranquilizer (iii) Antiseptic (iv) Synthetic antihistamine Choose the most appropriate match.

1. (a)-(i), (b)-(iii), (c)-(iv), (d)-(ii)
2. (a)-(iii), (b)-(iv), (c)-(ii), (d)-(i)
3. (a)-(ii), (b)-(i), (c)-(iii), (d)-(iv)
4. (a)-(iii), (b)-(i), (c)-(iv), (d)-(ii)

Answer: (a)-(iii), (b)-(i), (c)-(iv), (d)-(ii)

Furacin is an antiseptic, arsphenamine is an antibiotic, dimetone is a synthetic antihistamine and Valium (diazepam) is a tranquilizer, giving (a)-(iii), (b)-(i), (c)-(iv), (d)-(ii).