Exams › JEE Main › Chemistry

Consider the compound X: CH3-CH(OH)-CH=CH-CH(OH)-CH3. Which of the following statements about the stereoisomers of X are correct?

1. The total number of stereoisomers possible for X is 6
2. The total number of diastereomers possible for X is 3
3. If the double bond in X has trans (E) configuration, the number of enantiomers possible for X is 4
4. If the double bond in X has cis (Z) configuration, the number of enantiomers possible for X is 2

Correct answer: If the double bond in X has cis (Z) configuration, the number of enantiomers possible for X is 2

Solution

X has two chiral centres and a C=C double bond (E/Z). Total stereoisomers = 2 (E/Z) x 2² (chiral centres) = 8, but meso forms reduce this. The cis isomer has one meso form, giving fewer stereoisomers for that geometry.

Related JEE Main Chemistry questions

• Two Fischer projections are drawn for a compound with adjacent stereocentres bearing CHO, OH, H and CH3 substituents. One projection is obtained from the other by rotating the entire formula 180 degrees in the plane of the paper. What is the stereochemical relationship between the two representations?
• Which of the following compounds shows geometrical isomerism?
• Which of the following compounds does NOT show geometrical isomerism?
• A 100 mL sample of a urea solution contains 6.02 × 10²⁰ molecules of urea. What is the molarity of the solution? (Take Avogadro constant, N_A = 6.02 × 10²³ mol^−1.)
• When 4.9 g of H2SO4 reacts with NaCl, the products formed are 6 g of sodium hydrogen sulphate and 1.825 g of HCl. What mass of NaCl was decomposed?
• Which of the following has the least mass?

⚔️ Practice JEE Main Chemistry free + battle 1v1 →