Exams › JEE Advanced › Chemistry
Consider the compound X: CH3-CH(OH)-CH=CH-CH(OH)-CH3. Which of the following statements about the stereoisomers of X are correct?
- The total number of stereoisomers possible for X is 6
- The total number of diastereomers possible for X is 3
- If the double bond in X has trans (E) configuration, the number of enantiomers possible for X is 4
- If the double bond in X has cis (Z) configuration, the number of enantiomers possible for X is 2
Correct answer: If the double bond in X has cis (Z) configuration, the number of enantiomers possible for X is 2
Solution
X has two chiral centres and a C=C double bond (E/Z). Total stereoisomers = 2 (E/Z) x 2² (chiral centres) = 8, but meso forms reduce this. The cis isomer has one meso form, giving fewer stereoisomers for that geometry.
Related JEE Advanced Chemistry questions
⚔️ Practice JEE Advanced Chemistry free + battle 1v1 →